C31H35NO10S3 — CID 99668987
tetramethyl 9'-ethoxy-5',5'-dimethyl-6'-[(2R)-2-methylbutanoyl]spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 99668987) has the molecular formula C31H35NO10S3 and a molecular weight of 677.82 g/mol. Its IUPAC name is tetramethyl 9'-ethoxy-5',5'-dimethyl-6'-[(2R)-2-methylbutanoyl]spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 9'-ethoxy-5',5'-dimethyl-6'-[(2R)-2-methylbutanoyl]spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 99668987 |
| Molecular Formula | C31H35NO10S3 |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 677.14 |
| IUPAC Name | tetramethyl 9'-ethoxy-5',5'-dimethyl-6'-[(2R)-2-methylbutanoyl]spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | CCOc1ccc2c(c1)C1=C(SC(C(=O)OC)=C(C(=O)OC)C13SC(C(=O)OC)=C(C(=O)OC)S3)C(C)(C)N2C(=O)[C@H](C)CC |
| InChI | InChI=1S/C31H35NO10S3/c1-10-15(3)25(33)32-18-13-12-16(42-11-2)14-17(18)19-24(30(32,4)5)43-21(27(35)39-7)20(26(34)38-6)31(19)44-22(28(36)40-8)23(45-31)29(37)41-9/h12-15H,10-11H2,1-9H3/t15-/m1/s1 |
| InChIKey | SLKAXZHMTXUCKM-OAHLLOKOSA-N |
| XLogP | 5.05 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|