C19H23NO2S3 — CID 3576765
1-(8-ethoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-methylbutan-1-one (PubChem CID 3576765) has the molecular formula C19H23NO2S3 and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-(8-ethoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-methylbutan-1-one.
| Compound Name | 1-(8-ethoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 3576765 |
| Molecular Formula | C19H23NO2S3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-(8-ethoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-methylbutan-1-one |
| SMILES | CCOc1ccc2c(c1)-c1c(ssc1=S)C(C)(C)N2C(=O)C(C)CC |
| InChI | InChI=1S/C19H23NO2S3/c1-6-11(3)17(21)20-14-9-8-12(22-7-2)10-13(14)15-16(19(20,4)5)24-25-18(15)23/h8-11H,6-7H2,1-5H3 |
| InChIKey | PXAFFVSFNFFRCY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|