C19H23N2O3S3+ — CID 4748933
1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-morpholin-4-ium-4-ylethanone (PubChem CID 4748933) has the molecular formula C19H23N2O3S3+ and a molecular weight of 423.61 g/mol. Its IUPAC name is 1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-morpholin-4-ium-4-ylethanone.
| Compound Name | 1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-morpholin-4-ium-4-ylethanone |
|---|---|
| PubChem CID | 4748933 |
| Molecular Formula | C19H23N2O3S3+ |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-2-morpholin-4-ium-4-ylethanone |
| SMILES | COc1ccc2c(c1)-c1c(ssc1=S)C(C)(C)N2C(=O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H22N2O3S3/c1-19(2)17-16(18(25)27-26-17)13-10-12(23-3)4-5-14(13)21(19)15(22)11-20-6-8-24-9-7-20/h4-5,10H,6-9,11H2,1-3H3/p+1 |
| InChIKey | NJXARNFNYOSTFX-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|