C30H24N2O4S3 — CID 6997905
2-[(2R)-1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione (PubChem CID 6997905) has the molecular formula C30H24N2O4S3 and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-[(2R)-1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6997905 |
| Molecular Formula | C30H24N2O4S3 |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | 2-[(2R)-1-(8-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)-c1c(ssc1=S)C(C)(C)N2C(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H24N2O4S3/c1-30(2)25-24(29(37)39-38-25)21-16-18(36-3)13-14-22(21)32(30)28(35)23(15-17-9-5-4-6-10-17)31-26(33)19-11-7-8-12-20(19)27(31)34/h4-14,16,23H,15H2,1-3H3 |
| InChIKey | DOGCDKHRQMLZNZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|