C29H26N2O3 — CID 1221173
2-[(2S)-1-oxo-3-phenyl-1-(2,2,4-trimethylquinolin-1-yl)propan-2-yl]isoindole-1,3-dione (PubChem CID 1221173) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[(2S)-1-oxo-3-phenyl-1-(2,2,4-trimethylquinolin-1-yl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-oxo-3-phenyl-1-(2,2,4-trimethylquinolin-1-yl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1221173 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[(2S)-1-oxo-3-phenyl-1-(2,2,4-trimethylquinolin-1-yl)propan-2-yl]isoindole-1,3-dione |
| SMILES | CC1=CC(C)(C)N(C(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H26N2O3/c1-19-18-29(2,3)31(24-16-10-9-13-21(19)24)28(34)25(17-20-11-5-4-6-12-20)30-26(32)22-14-7-8-15-23(22)27(30)33/h4-16,18,25H,17H2,1-3H3/t25-/m0/s1 |
| InChIKey | VDWWLXVTPZPACL-VWLOTQADSA-N |
| XLogP | 5.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|