C37H32N2O7S3 — CID 4207597
dimethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-2,2,6,8-tetramethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 4207597) has the molecular formula C37H32N2O7S3 and a molecular weight of 712.87 g/mol. Its IUPAC name is dimethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-2,2,6,8-tetramethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-2,2,6,8-tetramethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4207597 |
| Molecular Formula | C37H32N2O7S3 |
| Molecular Weight | 712.87 g/mol |
| Exact Mass | 712.14 |
| IUPAC Name | dimethyl 2-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-2,2,6,8-tetramethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)C(Cc3ccccc3)N3C(=O)c4ccccc4C3=O)c3c(C)cc(C)cc32)S1 |
| InChI | InChI=1S/C37H32N2O7S3/c1-19-16-20(2)27-24(17-19)26(36-48-28(34(43)45-5)29(49-36)35(44)46-6)30(47)37(3,4)39(27)33(42)25(18-21-12-8-7-9-13-21)38-31(40)22-14-10-11-15-23(22)32(38)41/h7-17,25H,18H2,1-6H3 |
| InChIKey | QWYXZYXANQSBSA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.87 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|