C22H20F3NO5S3 — CID 3117916
dimethyl 2-[2,2,6,7-tetramethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 3117916) has the molecular formula C22H20F3NO5S3 and a molecular weight of 531.60 g/mol. Its IUPAC name is dimethyl 2-[2,2,6,7-tetramethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2,2,6,7-tetramethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 3117916 |
| Molecular Formula | C22H20F3NO5S3 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | dimethyl 2-[2,2,6,7-tetramethyl-3-sulfanylidene-1-(2,2,2-trifluoroacetyl)quinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)C(F)(F)F)c3cc(C)c(C)cc32)S1 |
| InChI | InChI=1S/C22H20F3NO5S3/c1-9-7-11-12(8-10(9)2)26(20(29)22(23,24)25)21(3,4)16(32)13(11)19-33-14(17(27)30-5)15(34-19)18(28)31-6/h7-8H,1-6H3 |
| InChIKey | FFWYYWHKQUUOPQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|