C30H29NO7S3 — CID 2860922
dimethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,6-trimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 2860922) has the molecular formula C30H29NO7S3 and a molecular weight of 611.76 g/mol. Its IUPAC name is dimethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,6-trimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,6-trimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 2860922 |
| Molecular Formula | C30H29NO7S3 |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | dimethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,6-trimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)C=Cc3ccc(OC)c(OC)c3)c3ccc(C)cc32)S1 |
| InChI | InChI=1S/C30H29NO7S3/c1-16-8-11-19-18(14-16)23(29-40-24(27(33)37-6)25(41-29)28(34)38-7)26(39)30(2,3)31(19)22(32)13-10-17-9-12-20(35-4)21(15-17)36-5/h8-15H,1-7H3 |
| InChIKey | QOWUOCGWNSZRBJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|