C34H35NO7 — CID 3896981
[1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,4-trimethylquinolin-6-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 3896981) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is [1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,4-trimethylquinolin-6-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,4-trimethylquinolin-6-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3896981 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | [1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2,2,4-trimethylquinolin-6-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc3c(c2)C(C)=CC(C)(C)N3C(=O)C=Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C34H35NO7/c1-22-21-34(2,3)35(32(36)16-10-23-8-14-28(38-4)30(18-23)40-6)27-13-12-25(20-26(22)27)42-33(37)17-11-24-9-15-29(39-5)31(19-24)41-7/h8-21H,1-7H3 |
| InChIKey | HJBGJGQKJNTNQM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|