C30H27NO3 — CID 92971877
[2,2,4-trimethyl-1-[(E)-3-phenylprop-2-enoyl]quinolin-6-yl] (Z)-3-phenylprop-2-enoate (PubChem CID 92971877) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is [2,2,4-trimethyl-1-[(E)-3-phenylprop-2-enoyl]quinolin-6-yl] (Z)-3-phenylprop-2-enoate.
| Compound Name | [2,2,4-trimethyl-1-[(E)-3-phenylprop-2-enoyl]quinolin-6-yl] (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 92971877 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2,2,4-trimethyl-1-[(E)-3-phenylprop-2-enoyl]quinolin-6-yl] (Z)-3-phenylprop-2-enoate |
| SMILES | CC1=CC(C)(C)N(C(=O)/C=C/c2ccccc2)c2ccc(OC(=O)/C=C\c3ccccc3)cc21 |
| InChI | InChI=1S/C30H27NO3/c1-22-21-30(2,3)31(28(32)18-14-23-10-6-4-7-11-23)27-17-16-25(20-26(22)27)34-29(33)19-15-24-12-8-5-9-13-24/h4-21H,1-3H3/b18-14+,19-15- |
| InChIKey | IIFVKEOOJCVEJF-CBSGOVTASA-N |
| XLogP | 6.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|