C23H19NO4 — CID 3610991
(9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 3-phenylprop-2-enoate (PubChem CID 3610991) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 3-phenylprop-2-enoate.
| Compound Name | (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3610991 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 3-phenylprop-2-enoate |
| SMILES | CC1=CC(C)(C)N2C(=O)C(=O)c3cc(OC(=O)C=Cc4ccccc4)cc1c32 |
| InChI | InChI=1S/C23H19NO4/c1-14-13-23(2,3)24-20-17(14)11-16(12-18(20)21(26)22(24)27)28-19(25)10-9-15-7-5-4-6-8-15/h4-13H,1-3H3 |
| InChIKey | SVIDEXSHVWZCQE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|