C26H19N3O6S2 — CID 3692641
[9,11,11-trimethyl-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl] 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 3692641) has the molecular formula C26H19N3O6S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is [9,11,11-trimethyl-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl] 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [9,11,11-trimethyl-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3692641 |
| Molecular Formula | C26H19N3O6S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | [9,11,11-trimethyl-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CC1=CC(C)(C)N2C(=O)C(=C3SC(=S)NC3=O)c3cc(OC(=O)C=Cc4cccc([N+](=O)[O-])c4)cc1c32 |
| InChI | InChI=1S/C26H19N3O6S2/c1-13-12-26(2,3)28-21-17(13)10-16(11-18(21)20(24(28)32)22-23(31)27-25(36)37-22)35-19(30)8-7-14-5-4-6-15(9-14)29(33)34/h4-12H,1-3H3,(H,27,31,36) |
| InChIKey | SIDRCHRFYKSUCV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|