C12H7N3O4S2 — CID 6278625
(5Z)-5-(1-methyl-5-nitro-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6278625) has the molecular formula C12H7N3O4S2 and a molecular weight of 321.34 g/mol. Its IUPAC name is (5Z)-5-(1-methyl-5-nitro-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(1-methyl-5-nitro-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6278625 |
| Molecular Formula | C12H7N3O4S2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | (5Z)-5-(1-methyl-5-nitro-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C2\SC(=S)NC2=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H7N3O4S2/c1-14-7-3-2-5(15(18)19)4-6(7)8(11(14)17)9-10(16)13-12(20)21-9/h2-4H,1H3,(H,13,16,20)/b9-8- |
| InChIKey | UUTUFGZJGWSQCB-HJWRWDBZSA-N |
| XLogP | 1.43 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|