C14H10N2O3S — CID 23658673
5-methyl-3-nitrobenzo[b][1,4]benzothiazepin-6-one (PubChem CID 23658673) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 5-methyl-3-nitrobenzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 5-methyl-3-nitrobenzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 23658673 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5-methyl-3-nitrobenzo[b][1,4]benzothiazepin-6-one |
| SMILES | CN1C(=O)c2ccccc2Sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H10N2O3S/c1-15-11-8-9(16(18)19)6-7-13(11)20-12-5-3-2-4-10(12)14(15)17/h2-8H,1H3 |
| InChIKey | SWGFFMFGPMJUPG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|