C16H14N3O2S+ — CID 170913265
5-methyl-16-nitro-13-thia-2-aza-5-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene (PubChem CID 170913265) has the molecular formula C16H14N3O2S+ and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-methyl-16-nitro-13-thia-2-aza-5-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene.
| Compound Name | 5-methyl-16-nitro-13-thia-2-aza-5-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene |
|---|---|
| PubChem CID | 170913265 |
| Molecular Formula | C16H14N3O2S+ |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-methyl-16-nitro-13-thia-2-aza-5-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),5,7,9,11,15,17-heptaene |
| SMILES | C[N+]1=C2c3ccccc3Sc3cc([N+](=O)[O-])ccc3N2CC1 |
| InChI | InChI=1S/C16H14N3O2S/c1-17-8-9-18-13-7-6-11(19(20)21)10-15(13)22-14-5-3-2-4-12(14)16(17)18/h2-7,10H,8-9H2,1H3/q+1 |
| InChIKey | QMLXTHSIAJCFRZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|