C12H8ClN3O2S — CID 87379332
3-(6-chloro-2-pyridinyl)-6-nitro-2H-1,3-benzothiazole (PubChem CID 87379332) has the molecular formula C12H8ClN3O2S and a molecular weight of 293.74 g/mol. Its IUPAC name is 3-(6-chloro-2-pyridinyl)-6-nitro-2H-1,3-benzothiazole.
| Compound Name | 3-(6-chloro-2-pyridinyl)-6-nitro-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 87379332 |
| Molecular Formula | C12H8ClN3O2S |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-(6-chloro-2-pyridinyl)-6-nitro-2H-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SCN2c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H8ClN3O2S/c13-11-2-1-3-12(14-11)15-7-19-10-6-8(16(17)18)4-5-9(10)15/h1-6H,7H2 |
| InChIKey | BPYHKYPDVKQERR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|