C15H14ClN3O2 — CID 114524511
2-(2-chloro-4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114524511) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(2-chloro-4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114524511 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-(2-chloro-4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(c1ccc([N+](=O)[O-])cc1Cl)CC2 |
| InChI | InChI=1S/C15H14ClN3O2/c16-13-8-11(19(20)21)4-5-15(13)18-7-6-10-2-1-3-14(17)12(10)9-18/h1-5,8H,6-7,9,17H2 |
| InChIKey | LVGKVSIMFNYFCA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|