C9H8FN3O2S — CID 90911568
4-(2-fluoroethyl)-7-nitro-1,2,4-benzothiadiazine (PubChem CID 90911568) has the molecular formula C9H8FN3O2S and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-7-nitro-1,2,4-benzothiadiazine.
| Compound Name | 4-(2-fluoroethyl)-7-nitro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 90911568 |
| Molecular Formula | C9H8FN3O2S |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 4-(2-fluoroethyl)-7-nitro-1,2,4-benzothiadiazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SN=CN2CCF |
| InChI | InChI=1S/C9H8FN3O2S/c10-3-4-12-6-11-16-9-5-7(13(14)15)1-2-8(9)12/h1-2,5-6H,3-4H2 |
| InChIKey | JYBMGAUAMCNVRK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|