C17H18ClN3O4 — CID 171340567
5-(4-aminobutyl)-2-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride (PubChem CID 171340567) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 5-(4-aminobutyl)-2-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride.
| Compound Name | 5-(4-aminobutyl)-2-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride |
|---|---|
| PubChem CID | 171340567 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 5-(4-aminobutyl)-2-nitrobenzo[b][1,4]benzoxazepin-6-one;hydrochloride |
| SMILES | Cl.NCCCCN1C(=O)c2ccccc2Oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H17N3O4.ClH/c18-9-3-4-10-19-14-8-7-12(20(22)23)11-16(14)24-15-6-2-1-5-13(15)17(19)21;/h1-2,5-8,11H,3-4,9-10,18H2;1H |
| InChIKey | ZJWQKHCYUSXGNI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|