C24H22N4O6 — CID 162171519
2-(3-nitrophenyl)ethanamine;2-[2-(3-nitrophenyl)ethyl]isoindole-1,3-dione (PubChem CID 162171519) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-(3-nitrophenyl)ethanamine;2-[2-(3-nitrophenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-(3-nitrophenyl)ethanamine;2-[2-(3-nitrophenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162171519 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-(3-nitrophenyl)ethanamine;2-[2-(3-nitrophenyl)ethyl]isoindole-1,3-dione |
| SMILES | NCCc1cccc([N+](=O)[O-])c1.O=C1c2ccccc2C(=O)N1CCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N2O4.C8H10N2O2/c19-15-13-6-1-2-7-14(13)16(20)17(15)9-8-11-4-3-5-12(10-11)18(21)22;9-5-4-7-2-1-3-8(6-7)10(11)12/h1-7,10H,8-9H2;1-3,6H,4-5,9H2 |
| InChIKey | ZNVXRXBJCGZJDU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|