C17H18N3O2+ — CID 14872022
1-methyl-3-(4-nitrophenyl)-2-phenyl-5,6-dihydro-4H-pyrimidin-1-ium (PubChem CID 14872022) has the molecular formula C17H18N3O2+ and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-methyl-3-(4-nitrophenyl)-2-phenyl-5,6-dihydro-4H-pyrimidin-1-ium.
| Compound Name | 1-methyl-3-(4-nitrophenyl)-2-phenyl-5,6-dihydro-4H-pyrimidin-1-ium |
|---|---|
| PubChem CID | 14872022 |
| Molecular Formula | C17H18N3O2+ |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-methyl-3-(4-nitrophenyl)-2-phenyl-5,6-dihydro-4H-pyrimidin-1-ium |
| SMILES | C[N+]1=C(c2ccccc2)N(c2ccc([N+](=O)[O-])cc2)CCC1 |
| InChI | InChI=1S/C17H18N3O2/c1-18-12-5-13-19(17(18)14-6-3-2-4-7-14)15-8-10-16(11-9-15)20(21)22/h2-4,6-11H,5,12-13H2,1H3/q+1 |
| InChIKey | OYBMWSDGPYCJHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|