C12H6N2O5S — CID 24973293
3,7-dinitrophenoxathiine (PubChem CID 24973293) has the molecular formula C12H6N2O5S and a molecular weight of 290.26 g/mol. Its IUPAC name is 3,7-dinitrophenoxathiine.
| Compound Name | 3,7-dinitrophenoxathiine |
|---|---|
| PubChem CID | 24973293 |
| Molecular Formula | C12H6N2O5S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 3,7-dinitrophenoxathiine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Oc1cc([N+](=O)[O-])ccc1S2 |
| InChI | InChI=1S/C12H6N2O5S/c15-13(16)7-1-3-11-9(5-7)19-10-6-8(14(17)18)2-4-12(10)20-11/h1-6H |
| InChIKey | WEEVLRFUMVEWLK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|