C24H15N3O4S — CID 122381288
3,7-bis(4-nitrophenyl)-10H-phenothiazine (PubChem CID 122381288) has the molecular formula C24H15N3O4S and a molecular weight of 441.47 g/mol. Its IUPAC name is 3,7-bis(4-nitrophenyl)-10H-phenothiazine.
| Compound Name | 3,7-bis(4-nitrophenyl)-10H-phenothiazine |
|---|---|
| PubChem CID | 122381288 |
| Molecular Formula | C24H15N3O4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 3,7-bis(4-nitrophenyl)-10H-phenothiazine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc([N+](=O)[O-])cc4)ccc2N3)cc1 |
| InChI | InChI=1S/C24H15N3O4S/c28-26(29)19-7-1-15(2-8-19)17-5-11-21-23(13-17)32-24-14-18(6-12-22(24)25-21)16-3-9-20(10-4-16)27(30)31/h1-14,25H |
| InChIKey | QIURHUJVALKNEP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|