About 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide
1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide (PubChem CID 175945051) has the molecular formula C26H17N5O6S
and a molecular weight of 527.52 g/mol. Its IUPAC name is 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide.
Molecular Properties
| Compound Name | 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide |
| PubChem CID | 175945051 |
| Molecular Formula | C26H17N5O6S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(c1)Sc1cc(C(N)=O)c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c1N2 |
| InChI | InChI=1S/C26H17N5O6S/c27-25(32)15-5-10-19-20(11-15)38-21-12-18(26(28)33)22(13-1-6-16(7-2-13)30(34)35)23(24(21)29-19)14-3-8-17(9-4-14)31(36)37/h1-12,29H,(H2,27,32)(H2,28,33) |
| InChIKey | UKITZTSPBVTBRQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide?
The IUPAC name of 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide (CID 175945051) is 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide.
What is the SMILES notation for 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide?
The canonical SMILES for 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide is NC(=O)c1ccc2c(c1)Sc1cc(C(N)=O)c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c1N2.
What is the InChIKey of 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide?
The InChIKey is UKITZTSPBVTBRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17N5O6S/c27-25(32)15-5-10-19-20(11-15)38-21-12-18(26(28)33)22(13-1-6-16(7-2-13)30(34)35)23(24(21)29-19)14-3-8-17(9-4-14)31(36)37/h1-12,29H,(H2,27,32)(H2,28,33).
What are the key properties of 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide?
1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide has a molecular weight of 527.52 g/mol, XLogP of 5.24, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide is sourced from PubChem (CID 175945051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).