C26H17N5O6S — CID 175945051
1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide (PubChem CID 175945051) has the molecular formula C26H17N5O6S and a molecular weight of 527.52 g/mol. Its IUPAC name is 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide.
| Compound Name | 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide |
|---|---|
| PubChem CID | 175945051 |
| Molecular Formula | C26H17N5O6S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1,2-bis(4-nitrophenyl)-10H-phenothiazine-3,7-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(c1)Sc1cc(C(N)=O)c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c1N2 |
| InChI | InChI=1S/C26H17N5O6S/c27-25(32)15-5-10-19-20(11-15)38-21-12-18(26(28)33)22(13-1-6-16(7-2-13)30(34)35)23(24(21)29-19)14-3-8-17(9-4-14)31(36)37/h1-12,29H,(H2,27,32)(H2,28,33) |
| InChIKey | UKITZTSPBVTBRQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|