C21H13N3O5S — CID 175055968
1-(4-nitrophenyl)-9-oxothioxanthene-3,6-dicarboxamide (PubChem CID 175055968) has the molecular formula C21H13N3O5S and a molecular weight of 419.42 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-9-oxothioxanthene-3,6-dicarboxamide.
| Compound Name | 1-(4-nitrophenyl)-9-oxothioxanthene-3,6-dicarboxamide |
|---|---|
| PubChem CID | 175055968 |
| Molecular Formula | C21H13N3O5S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-(4-nitrophenyl)-9-oxothioxanthene-3,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(=O)c3c(-c4ccc([N+](=O)[O-])cc4)cc(C(N)=O)cc3sc2c1 |
| InChI | InChI=1S/C21H13N3O5S/c22-20(26)11-3-6-14-16(8-11)30-17-9-12(21(23)27)7-15(18(17)19(14)25)10-1-4-13(5-2-10)24(28)29/h1-9H,(H2,22,26)(H2,23,27) |
| InChIKey | RIRFGLWOLIFVBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|