C14H8N2O4S — CID 11472096
6-(4-nitrobenzoyl)-3H-1,3-benzothiazol-2-one (PubChem CID 11472096) has the molecular formula C14H8N2O4S and a molecular weight of 300.30 g/mol. Its IUPAC name is 6-(4-nitrobenzoyl)-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-(4-nitrobenzoyl)-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 11472096 |
| Molecular Formula | C14H8N2O4S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 6-(4-nitrobenzoyl)-3H-1,3-benzothiazol-2-one |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1ccc2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C14H8N2O4S/c17-13(8-1-4-10(5-2-8)16(19)20)9-3-6-11-12(7-9)21-14(18)15-11/h1-7H,(H,15,18) |
| InChIKey | XOELCHUNADDTMS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|