C39H26N6O7S — CID 154630138
2-N,6-N-bis[4-(4-nitroanilino)phenyl]-9-oxothioxanthene-2,6-dicarboxamide (PubChem CID 154630138) has the molecular formula C39H26N6O7S and a molecular weight of 722.74 g/mol. Its IUPAC name is 2-N,6-N-bis[4-(4-nitroanilino)phenyl]-9-oxothioxanthene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-(4-nitroanilino)phenyl]-9-oxothioxanthene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 154630138 |
| Molecular Formula | C39H26N6O7S |
| Molecular Weight | 722.74 g/mol |
| Exact Mass | 722.16 |
| IUPAC Name | 2-N,6-N-bis[4-(4-nitroanilino)phenyl]-9-oxothioxanthene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc([N+](=O)[O-])cc2)cc1)c1ccc2c(=O)c3cc(C(=O)Nc4ccc(Nc5ccc([N+](=O)[O-])cc5)cc4)ccc3sc2c1 |
| InChI | InChI=1S/C39H26N6O7S/c46-37-33-19-1-24(39(48)43-30-9-5-26(6-10-30)41-28-13-17-32(18-14-28)45(51)52)22-36(33)53-35-20-2-23(21-34(35)37)38(47)42-29-7-3-25(4-8-29)40-27-11-15-31(16-12-27)44(49)50/h1-22,40-41H,(H,42,47)(H,43,48) |
| InChIKey | VMENZBSGXSQODO-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.74 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|