C13H10N2O6 — CID 10541486
3,4,5-trihydroxy-N-(4-nitrophenyl)benzamide (PubChem CID 10541486) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-(4-nitrophenyl)benzamide.
| Compound Name | 3,4,5-trihydroxy-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 10541486 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3,4,5-trihydroxy-N-(4-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H10N2O6/c16-10-5-7(6-11(17)12(10)18)13(19)14-8-1-3-9(4-2-8)15(20)21/h1-6,16-18H,(H,14,19) |
| InChIKey | JYIUNLUTPUEHRI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|