C23H12N4O7S3 — CID 154630141
2-N,6-N-bis(5-nitrothiophen-2-yl)-9-oxothioxanthene-2,6-dicarboxamide (PubChem CID 154630141) has the molecular formula C23H12N4O7S3 and a molecular weight of 552.57 g/mol. Its IUPAC name is 2-N,6-N-bis(5-nitrothiophen-2-yl)-9-oxothioxanthene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(5-nitrothiophen-2-yl)-9-oxothioxanthene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 154630141 |
| Molecular Formula | C23H12N4O7S3 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 551.99 |
| IUPAC Name | 2-N,6-N-bis(5-nitrothiophen-2-yl)-9-oxothioxanthene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])s1)c1ccc2c(=O)c3cc(C(=O)Nc4ccc([N+](=O)[O-])s4)ccc3sc2c1 |
| InChI | InChI=1S/C23H12N4O7S3/c28-21-13-3-1-12(23(30)25-18-6-8-20(37-18)27(33)34)10-16(13)35-15-4-2-11(9-14(15)21)22(29)24-17-5-7-19(36-17)26(31)32/h1-10H,(H,24,29)(H,25,30) |
| InChIKey | OFWOYVYSDFIWPO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|