C24H14N4O7S2 — CID 154632324
2-N,6-N-bis(5-nitrothiophen-2-yl)-10-oxo-9H-anthracene-2,6-dicarboxamide (PubChem CID 154632324) has the molecular formula C24H14N4O7S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is 2-N,6-N-bis(5-nitrothiophen-2-yl)-10-oxo-9H-anthracene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(5-nitrothiophen-2-yl)-10-oxo-9H-anthracene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 154632324 |
| Molecular Formula | C24H14N4O7S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | 2-N,6-N-bis(5-nitrothiophen-2-yl)-10-oxo-9H-anthracene-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])s1)c1ccc2c(c1)Cc1ccc(C(=O)Nc3ccc([N+](=O)[O-])s3)cc1C2=O |
| InChI | InChI=1S/C24H14N4O7S2/c29-22-16-4-3-13(23(30)25-18-5-7-20(36-18)27(32)33)10-15(16)9-12-1-2-14(11-17(12)22)24(31)26-19-6-8-21(37-19)28(34)35/h1-8,10-11H,9H2,(H,25,30)(H,26,31) |
| InChIKey | CUUCMACSAVLEFS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|