C23H19N5O2S2 — CID 151844776
2-N,6-N-bis(5-aminothiophen-2-yl)-9,10-dihydroacridine-2,6-dicarboxamide (PubChem CID 151844776) has the molecular formula C23H19N5O2S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-N,6-N-bis(5-aminothiophen-2-yl)-9,10-dihydroacridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(5-aminothiophen-2-yl)-9,10-dihydroacridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 151844776 |
| Molecular Formula | C23H19N5O2S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-N,6-N-bis(5-aminothiophen-2-yl)-9,10-dihydroacridine-2,6-dicarboxamide |
| SMILES | Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccc(C(=O)Nc4ccc(N)s4)cc2N3)s1 |
| InChI | InChI=1S/C23H19N5O2S2/c24-18-5-7-20(31-18)27-22(29)13-3-4-16-15(10-13)9-12-1-2-14(11-17(12)26-16)23(30)28-21-8-6-19(25)32-21/h1-8,10-11,26H,9,24-25H2,(H,27,29)(H,28,30) |
| InChIKey | SHKQPUCXPYFGHH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |