C17H17N3O4S — CID 167928666
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 167928666) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 167928666 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)c2ccc3c(c2)CC(=O)N3)c1C |
| InChI | InChI=1S/C17H17N3O4S/c1-9-5-13(25(18,23)24)8-15(10(9)2)20-17(22)11-3-4-14-12(6-11)7-16(21)19-14/h3-6,8H,7H2,1-2H3,(H,19,21)(H,20,22)(H2,18,23,24) |
| InChIKey | JNASSAVVXVAFOK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |