C18H22N2O3S — CID 9141346
N-(2,3-dimethyl-5-sulfamoylphenyl)-4-propan-2-ylbenzamide (PubChem CID 9141346) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-4-propan-2-ylbenzamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 9141346 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-4-propan-2-ylbenzamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)c2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C18H22N2O3S/c1-11(2)14-5-7-15(8-6-14)18(21)20-17-10-16(24(19,22)23)9-12(3)13(17)4/h5-11H,1-4H3,(H,20,21)(H2,19,22,23) |
| InChIKey | SBLURZZEKMICSR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |