C13H13N3 — CID 138605968
9,10-dihydroacridine-2,6-diamine (PubChem CID 138605968) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 9,10-dihydroacridine-2,6-diamine.
| Compound Name | 9,10-dihydroacridine-2,6-diamine |
|---|---|
| PubChem CID | 138605968 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 9,10-dihydroacridine-2,6-diamine |
| SMILES | Nc1ccc2c(c1)Cc1ccc(N)cc1N2 |
| InChI | InChI=1S/C13H13N3/c14-10-3-4-12-9(6-10)5-8-1-2-11(15)7-13(8)16-12/h1-4,6-7,16H,5,14-15H2 |
| InChIKey | SYQWBQUJHZAYLH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|