C16H16N2 — CID 144662163
11-methylidene-10,12-dihydro-5H-benzo[d][1]benzazocin-2-amine (PubChem CID 144662163) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 11-methylidene-10,12-dihydro-5H-benzo[d][1]benzazocin-2-amine.
| Compound Name | 11-methylidene-10,12-dihydro-5H-benzo[d][1]benzazocin-2-amine |
|---|---|
| PubChem CID | 144662163 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 11-methylidene-10,12-dihydro-5H-benzo[d][1]benzazocin-2-amine |
| SMILES | C=C1Cc2cc(N)ccc2Cc2ccccc2N1 |
| InChI | InChI=1S/C16H16N2/c1-11-8-14-10-15(17)7-6-12(14)9-13-4-2-3-5-16(13)18-11/h2-7,10,18H,1,8-9,17H2 |
| InChIKey | NZKBZAPMZUPXEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|