C24H15N3O4S3 — CID 166524002
3,7-bis[(4-nitrophenyl)sulfanyl]-10H-phenothiazine (PubChem CID 166524002) has the molecular formula C24H15N3O4S3 and a molecular weight of 505.60 g/mol. Its IUPAC name is 3,7-bis[(4-nitrophenyl)sulfanyl]-10H-phenothiazine.
| Compound Name | 3,7-bis[(4-nitrophenyl)sulfanyl]-10H-phenothiazine |
|---|---|
| PubChem CID | 166524002 |
| Molecular Formula | C24H15N3O4S3 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 3,7-bis[(4-nitrophenyl)sulfanyl]-10H-phenothiazine |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc3c(c2)Sc2cc(Sc4ccc([N+](=O)[O-])cc4)ccc2N3)cc1 |
| InChI | InChI=1S/C24H15N3O4S3/c28-26(29)15-1-5-17(6-2-15)32-19-9-11-21-23(13-19)34-24-14-20(10-12-22(24)25-21)33-18-7-3-16(4-8-18)27(30)31/h1-14,25H |
| InChIKey | AMQVUDAXBVZLPY-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|