C18H10N2O6S2 — CID 5161150
2,5-bis[(4-nitrophenyl)sulfanyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 5161150) has the molecular formula C18H10N2O6S2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2,5-bis[(4-nitrophenyl)sulfanyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[(4-nitrophenyl)sulfanyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5161150 |
| Molecular Formula | C18H10N2O6S2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 2,5-bis[(4-nitrophenyl)sulfanyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(Sc2ccc([N+](=O)[O-])cc2)C(=O)C=C1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H10N2O6S2/c21-15-10-18(28-14-7-3-12(4-8-14)20(25)26)16(22)9-17(15)27-13-5-1-11(2-6-13)19(23)24/h1-10H |
| InChIKey | FUVQCFYRRXGXPL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|