C9H7NO4S — CID 122199105
8-nitro-1,5-benzoxathiepin-3-one (PubChem CID 122199105) has the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. Its IUPAC name is 8-nitro-1,5-benzoxathiepin-3-one.
| Compound Name | 8-nitro-1,5-benzoxathiepin-3-one |
|---|---|
| PubChem CID | 122199105 |
| Molecular Formula | C9H7NO4S |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 8-nitro-1,5-benzoxathiepin-3-one |
| SMILES | O=C1COc2cc([N+](=O)[O-])ccc2SC1 |
| InChI | InChI=1S/C9H7NO4S/c11-7-4-14-8-3-6(10(12)13)1-2-9(8)15-5-7/h1-3H,4-5H2 |
| InChIKey | IAPVGYGZEQYUBR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|