C16H10N2O4S — CID 134124913
(3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-6-nitro-2-benzofuran-1-one (PubChem CID 134124913) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is (3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-6-nitro-2-benzofuran-1-one.
| Compound Name | (3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-6-nitro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134124913 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)-6-nitro-2-benzofuran-1-one |
| SMILES | CN1/C(=C2\OC(=O)c3cc([N+](=O)[O-])ccc32)Sc2ccccc21 |
| InChI | InChI=1S/C16H10N2O4S/c1-17-12-4-2-3-5-13(12)23-15(17)14-10-7-6-9(18(20)21)8-11(10)16(19)22-14/h2-8H,1H3/b15-14+ |
| InChIKey | HLJDVVKBFSGTAL-CCEZHUSRSA-N |
| XLogP | 3.63 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|