C18H15N3O2S — CID 6998740
(E)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-N-(3-nitrophenyl)but-2-en-1-imine (PubChem CID 6998740) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is (E)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-N-(3-nitrophenyl)but-2-en-1-imine.
| Compound Name | (E)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-N-(3-nitrophenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 6998740 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (E)-4-(3-methyl-1,3-benzothiazol-2-ylidene)-N-(3-nitrophenyl)but-2-en-1-imine |
| SMILES | CN1C(=C/C=C/C=N/c2cccc([N+](=O)[O-])c2)Sc2ccccc21 |
| InChI | InChI=1S/C18H15N3O2S/c1-20-16-9-2-3-10-17(16)24-18(20)11-4-5-12-19-14-7-6-8-15(13-14)21(22)23/h2-13H,1H3/b5-4+,18-11?,19-12+ |
| InChIKey | LACZKAPLPICVAR-WKBSRQNUSA-N |
| XLogP | 4.94 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|