C10H6N2O2S3 — CID 23740115
5-[(3-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dithione (PubChem CID 23740115) has the molecular formula C10H6N2O2S3 and a molecular weight of 282.37 g/mol. Its IUPAC name is 5-[(3-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dithione.
| Compound Name | 5-[(3-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dithione |
|---|---|
| PubChem CID | 23740115 |
| Molecular Formula | C10H6N2O2S3 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 5-[(3-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dithione |
| SMILES | O=[N+]([O-])c1cccc(C=C2SC(=S)NC2=S)c1 |
| InChI | InChI=1S/C10H6N2O2S3/c13-12(14)7-3-1-2-6(4-7)5-8-9(15)11-10(16)17-8/h1-5H,(H,11,15,16) |
| InChIKey | VTAPXYXSYUDGGC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|