C15H18ClNO2 — CID 20558605
6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride (PubChem CID 20558605) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride.
| Compound Name | 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride |
|---|---|
| PubChem CID | 20558605 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)Cl |
| InChI | InChI=1S/C15H18ClNO2/c1-5-19-11-6-7-13-12(8-11)10(2)9-15(3,4)17(13)14(16)18/h6-9H,5H2,1-4H3 |
| InChIKey | NLZOZEZZWKNNOF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|