6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride

C15H18ClNO2 — CID 20558605

IUPAC6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride
SMILESCCOc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)Cl
InChIInChI=1S/C15H18ClNO2/c1-5-19-11-6-7-13-12(8-11)10(2)9-15(3,4)17(13)14(16)18/h6-9H,5H2,1-4H3
InChIKeyNLZOZEZZWKNNOF-UHFFFAOYSA-N
MW279.77 g/mol
LogP4.45
Rot. Bonds2

About 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride

6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride (PubChem CID 20558605) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride.

Molecular Properties

Compound Name6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride
PubChem CID20558605
Molecular FormulaC15H18ClNO2
Molecular Weight279.77 g/mol
Exact Mass279.10
IUPAC Name6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride
SMILESCCOc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)Cl
InChIInChI=1S/C15H18ClNO2/c1-5-19-11-6-7-13-12(8-11)10(2)9-15(3,4)17(13)14(16)18/h6-9H,5H2,1-4H3
InChIKeyNLZOZEZZWKNNOF-UHFFFAOYSA-N
XLogP4.45
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.77
LogP ≤ 54.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride?
The IUPAC name of 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride (CID 20558605) is 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride.
What is the SMILES notation for 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride?
The canonical SMILES for 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride is CCOc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)Cl.
What is the InChIKey of 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride?
The InChIKey is NLZOZEZZWKNNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO2/c1-5-19-11-6-7-13-12(8-11)10(2)9-15(3,4)17(13)14(16)18/h6-9H,5H2,1-4H3.
What are the key properties of 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride?
6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride has a molecular weight of 279.77 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,2,4-trimethylquinoline-1-carbonyl chloride is sourced from PubChem (CID 20558605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).