C31H45NO2 — CID 54328898
1-[2,2,4-trimethyl-6-(5,9,13-trimethyltetradeca-4,8,12-trienoxy)quinolin-1-yl]ethanone (PubChem CID 54328898) has the molecular formula C31H45NO2 and a molecular weight of 463.71 g/mol. Its IUPAC name is 1-[2,2,4-trimethyl-6-(5,9,13-trimethyltetradeca-4,8,12-trienoxy)quinolin-1-yl]ethanone.
| Compound Name | 1-[2,2,4-trimethyl-6-(5,9,13-trimethyltetradeca-4,8,12-trienoxy)quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 54328898 |
| Molecular Formula | C31H45NO2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 1-[2,2,4-trimethyl-6-(5,9,13-trimethyltetradeca-4,8,12-trienoxy)quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(OCCCC=C(C)CCC=C(C)CCC=C(C)C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C31H45NO2/c1-23(2)13-11-15-25(4)17-12-16-24(3)14-9-10-20-34-28-18-19-30-29(21-28)26(5)22-31(7,8)32(30)27(6)33/h13-14,17-19,21-22H,9-12,15-16,20H2,1-8H3 |
| InChIKey | SWXXMOAXHDAFTF-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|