C24H36O3S — CID 57270588
5,9,13-trimethyltetradeca-4,8,12-trienyl 3-methylbenzenesulfonate (PubChem CID 57270588) has the molecular formula C24H36O3S and a molecular weight of 404.62 g/mol. Its IUPAC name is 5,9,13-trimethyltetradeca-4,8,12-trienyl 3-methylbenzenesulfonate.
| Compound Name | 5,9,13-trimethyltetradeca-4,8,12-trienyl 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57270588 |
| Molecular Formula | C24H36O3S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 5,9,13-trimethyltetradeca-4,8,12-trienyl 3-methylbenzenesulfonate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCCOS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C24H36O3S/c1-20(2)11-8-13-22(4)15-9-14-21(3)12-6-7-18-27-28(25,26)24-17-10-16-23(5)19-24/h10-12,15-17,19H,6-9,13-14,18H2,1-5H3 |
| InChIKey | DHGQYYDVKHYXOX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|