C21H22ClNO2 — CID 7299544
(2R)-2-chloro-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-phenylethanone (PubChem CID 7299544) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is (2R)-2-chloro-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-phenylethanone.
| Compound Name | (2R)-2-chloro-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 7299544 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2R)-2-chloro-1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)-2-phenylethanone |
| SMILES | COc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO2/c1-14-13-21(2,3)23(18-11-10-16(25-4)12-17(14)18)20(24)19(22)15-8-6-5-7-9-15/h5-13,19H,1-4H3/t19-/m1/s1 |
| InChIKey | RWYYCWBQAJQOIK-LJQANCHMSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|