C26H23NO3 — CID 1106529
(1-benzoyl-2,2,4-trimethylquinolin-6-yl) benzoate (PubChem CID 1106529) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is (1-benzoyl-2,2,4-trimethylquinolin-6-yl) benzoate.
| Compound Name | (1-benzoyl-2,2,4-trimethylquinolin-6-yl) benzoate |
|---|---|
| PubChem CID | 1106529 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1-benzoyl-2,2,4-trimethylquinolin-6-yl) benzoate |
| SMILES | CC1=CC(C)(C)N(C(=O)c2ccccc2)c2ccc(OC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C26H23NO3/c1-18-17-26(2,3)27(24(28)19-10-6-4-7-11-19)23-15-14-21(16-22(18)23)30-25(29)20-12-8-5-9-13-20/h4-17H,1-3H3 |
| InChIKey | MFQWHYROSXKEEH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|