C35H33NO4 — CID 58026801
[1-benzoyl-6-(2-ethoxyphenyl)-2,2,4-trimethylquinolin-5-yl]methyl benzoate (PubChem CID 58026801) has the molecular formula C35H33NO4 and a molecular weight of 531.65 g/mol. Its IUPAC name is [1-benzoyl-6-(2-ethoxyphenyl)-2,2,4-trimethylquinolin-5-yl]methyl benzoate.
| Compound Name | [1-benzoyl-6-(2-ethoxyphenyl)-2,2,4-trimethylquinolin-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 58026801 |
| Molecular Formula | C35H33NO4 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | [1-benzoyl-6-(2-ethoxyphenyl)-2,2,4-trimethylquinolin-5-yl]methyl benzoate |
| SMILES | CCOc1ccccc1-c1ccc2c(c1COC(=O)c1ccccc1)C(C)=CC(C)(C)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H33NO4/c1-5-39-31-19-13-12-18-28(31)27-20-21-30-32(29(27)23-40-34(38)26-16-10-7-11-17-26)24(2)22-35(3,4)36(30)33(37)25-14-8-6-9-15-25/h6-22H,5,23H2,1-4H3 |
| InChIKey | LUGMWMQMQXVFFL-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |