C24H27NO3 — CID 58026791
[6-(2-methoxyphenyl)-1,2,2,4-tetramethylquinolin-5-yl]methyl prop-2-enoate (PubChem CID 58026791) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is [6-(2-methoxyphenyl)-1,2,2,4-tetramethylquinolin-5-yl]methyl prop-2-enoate.
| Compound Name | [6-(2-methoxyphenyl)-1,2,2,4-tetramethylquinolin-5-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 58026791 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [6-(2-methoxyphenyl)-1,2,2,4-tetramethylquinolin-5-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1c(-c2ccccc2OC)ccc2c1C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C24H27NO3/c1-7-22(26)28-15-19-17(18-10-8-9-11-21(18)27-6)12-13-20-23(19)16(2)14-24(3,4)25(20)5/h7-14H,1,15H2,2-6H3 |
| InChIKey | CUBSHISKASDADR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|