C19H27NO3 — CID 132650701
methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate (PubChem CID 132650701) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate.
| Compound Name | methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate |
|---|---|
| PubChem CID | 132650701 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate |
| SMILES | CCCC(C(=O)OC)N1c2c(OC)cccc2C(C)=CC1(C)C |
| InChI | InChI=1S/C19H27NO3/c1-7-9-15(18(21)23-6)20-17-14(10-8-11-16(17)22-5)13(2)12-19(20,3)4/h8,10-12,15H,7,9H2,1-6H3 |
| InChIKey | NQWWGMOMMWAHNB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |