methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate

C19H27NO3 — CID 132650701

IUPACmethyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate
SMILESCCCC(C(=O)OC)N1c2c(OC)cccc2C(C)=CC1(C)C
InChIInChI=1S/C19H27NO3/c1-7-9-15(18(21)23-6)20-17-14(10-8-11-16(17)22-5)13(2)12-19(20,3)4/h8,10-12,15H,7,9H2,1-6H3
InChIKeyNQWWGMOMMWAHNB-UHFFFAOYSA-N
MW317.43 g/mol
LogP4.04
Rot. Bonds5

About methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate

methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate (PubChem CID 132650701) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate.

Molecular Properties

Compound Namemethyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate
PubChem CID132650701
Molecular FormulaC19H27NO3
Molecular Weight317.43 g/mol
Exact Mass317.20
IUPAC Namemethyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate
SMILESCCCC(C(=O)OC)N1c2c(OC)cccc2C(C)=CC1(C)C
InChIInChI=1S/C19H27NO3/c1-7-9-15(18(21)23-6)20-17-14(10-8-11-16(17)22-5)13(2)12-19(20,3)4/h8,10-12,15H,7,9H2,1-6H3
InChIKeyNQWWGMOMMWAHNB-UHFFFAOYSA-N
XLogP4.04
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.43
LogP ≤ 54.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate?
The IUPAC name of methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate (CID 132650701) is methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate.
What is the SMILES notation for methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate?
The canonical SMILES for methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate is CCCC(C(=O)OC)N1c2c(OC)cccc2C(C)=CC1(C)C.
What is the InChIKey of methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate?
The InChIKey is NQWWGMOMMWAHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-7-9-15(18(21)23-6)20-17-14(10-8-11-16(17)22-5)13(2)12-19(20,3)4/h8,10-12,15H,7,9H2,1-6H3.
What are the key properties of methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate?
methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate has a molecular weight of 317.43 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(8-methoxy-2,2,4-trimethylquinolin-1-yl)pentanoate is sourced from PubChem (CID 132650701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).