methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate

C18H25NO2 — CID 132649846

IUPACmethyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate
SMILESCCC(C(=O)OC)N1c2c(C)cccc2C(C)=CC1(C)C
InChIInChI=1S/C18H25NO2/c1-7-15(17(20)21-6)19-16-12(2)9-8-10-14(16)13(3)11-18(19,4)5/h8-11,15H,7H2,1-6H3
InChIKeyJLRLCAGCKHZKDP-UHFFFAOYSA-N
MW287.40 g/mol
LogP3.95
Rot. Bonds3

About methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate

methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate (PubChem CID 132649846) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate.

Molecular Properties

Compound Namemethyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate
PubChem CID132649846
Molecular FormulaC18H25NO2
Molecular Weight287.40 g/mol
Exact Mass287.19
IUPAC Namemethyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate
SMILESCCC(C(=O)OC)N1c2c(C)cccc2C(C)=CC1(C)C
InChIInChI=1S/C18H25NO2/c1-7-15(17(20)21-6)19-16-12(2)9-8-10-14(16)13(3)11-18(19,4)5/h8-11,15H,7H2,1-6H3
InChIKeyJLRLCAGCKHZKDP-UHFFFAOYSA-N
XLogP3.95
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.40
LogP ≤ 53.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate?
The IUPAC name of methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate (CID 132649846) is methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate.
What is the SMILES notation for methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate?
The canonical SMILES for methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate is CCC(C(=O)OC)N1c2c(C)cccc2C(C)=CC1(C)C.
What is the InChIKey of methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate?
The InChIKey is JLRLCAGCKHZKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-7-15(17(20)21-6)19-16-12(2)9-8-10-14(16)13(3)11-18(19,4)5/h8-11,15H,7H2,1-6H3.
What are the key properties of methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate?
methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate has a molecular weight of 287.40 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2,4,8-tetramethylquinolin-1-yl)butanoate is sourced from PubChem (CID 132649846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).